C15H29NO — CID 135141337
N-(3,3-dimethyldec-1-en-2-yl)-N-methylacetamide (PubChem CID 135141337) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is N-(3,3-dimethyldec-1-en-2-yl)-N-methylacetamide.
| Compound Name | N-(3,3-dimethyldec-1-en-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 135141337 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | N-(3,3-dimethyldec-1-en-2-yl)-N-methylacetamide |
| SMILES | C=C(N(C)C(C)=O)C(C)(C)CCCCCCC |
| InChI | InChI=1S/C15H29NO/c1-7-8-9-10-11-12-15(4,5)13(2)16(6)14(3)17/h2,7-12H2,1,3-6H3 |
| InChIKey | WDKBRKDRFRCZDU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|