C21H23N5O — CID 135141497
1-[(2S,4R)-4-(4-aminoanilino)-2-methyl-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 135141497) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-[(2S,4R)-4-(4-aminoanilino)-2-methyl-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2S,4R)-4-(4-aminoanilino)-2-methyl-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 135141497 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-[(2S,4R)-4-(4-aminoanilino)-2-methyl-6-(1H-pyrazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(-c3ccn[nH]3)cc2[C@H](Nc2ccc(N)cc2)C[C@@H]1C |
| InChI | InChI=1S/C21H23N5O/c1-13-11-20(24-17-6-4-16(22)5-7-17)18-12-15(19-9-10-23-25-19)3-8-21(18)26(13)14(2)27/h3-10,12-13,20,24H,11,22H2,1-2H3,(H,23,25)/t13-,20+/m0/s1 |
| InChIKey | MIHJWEPMFNLHBH-RNODOKPDSA-N |
| XLogP | 3.96 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|