C16H26N6O2 — CID 135144845
2-[4-(2-ethyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylic acid (PubChem CID 135144845) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[4-(2-ethyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylic acid.
| Compound Name | 2-[4-(2-ethyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylic acid |
|---|---|
| PubChem CID | 135144845 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-[4-(2-ethyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylic acid |
| SMILES | CCn1nnc(C2CCN(C3CC4(CCN(C(=O)O)C4)C3)CC2)n1 |
| InChI | InChI=1S/C16H26N6O2/c1-2-22-18-14(17-19-22)12-3-6-20(7-4-12)13-9-16(10-13)5-8-21(11-16)15(23)24/h12-13H,2-11H2,1H3,(H,23,24) |
| InChIKey | WWFDJJOOLSGGJA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |