C33H34N6OS — CID 135146000
1-[[8-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]anilino]-1,7-naphthyridin-3-yl]methyl]pyrrolidin-3-ol (PubChem CID 135146000) has the molecular formula C33H34N6OS and a molecular weight of 562.74 g/mol. Its IUPAC name is 1-[[8-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]anilino]-1,7-naphthyridin-3-yl]methyl]pyrrolidin-3-ol.
| Compound Name | 1-[[8-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]anilino]-1,7-naphthyridin-3-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 135146000 |
| Molecular Formula | C33H34N6OS |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 1-[[8-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]anilino]-1,7-naphthyridin-3-yl]methyl]pyrrolidin-3-ol |
| SMILES | Cc1c(Nc2nccc3cc(CN4CCC(O)C4)cnc23)cccc1-c1cccc(-c2nc3c(s2)CNCC3)c1C |
| InChI | InChI=1S/C33H34N6OS/c1-20-25(5-3-7-27(20)33-38-29-10-12-34-17-30(29)41-33)26-6-4-8-28(21(26)2)37-32-31-23(9-13-35-32)15-22(16-36-31)18-39-14-11-24(40)19-39/h3-9,13,15-16,24,34,40H,10-12,14,17-19H2,1-2H3,(H,35,37) |
| InChIKey | JJEVHYATMQBRIB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |