C34H30ClN7O2 — CID 135146575
8-chloro-2-[3-[3-[[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]-2-methylphenyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde (PubChem CID 135146575) has the molecular formula C34H30ClN7O2 and a molecular weight of 604.11 g/mol. Its IUPAC name is 8-chloro-2-[3-[3-[[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]-2-methylphenyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde.
| Compound Name | 8-chloro-2-[3-[3-[[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]-2-methylphenyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 135146575 |
| Molecular Formula | C34H30ClN7O2 |
| Molecular Weight | 604.11 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 8-chloro-2-[3-[3-[[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]-2-methylphenyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
| SMILES | Cc1c(Nc2nccc3cc(CN4CC[C@@H](O)C4)cnc23)cccc1-c1cccc(-c2nc3c(Cl)cc(C=O)cn3n2)c1C |
| InChI | InChI=1S/C34H30ClN7O2/c1-20-26(5-3-7-28(20)32-39-34-29(35)14-23(19-43)17-42(34)40-32)27-6-4-8-30(21(27)2)38-33-31-24(9-11-36-33)13-22(15-37-31)16-41-12-10-25(44)18-41/h3-9,11,13-15,17,19,25,44H,10,12,16,18H2,1-2H3,(H,36,38)/t25-/m1/s1 |
| InChIKey | NXDYQDZRYTVKMQ-RUZDIDTESA-N |
| XLogP | 6.40 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.11 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|