C23H34N2O4 — CID 135146235
tert-butyl 2-[[3-methoxy-2-methyl-3-[(2S)-4-methylidenepyrrolidin-2-yl]propanoyl]amino]-3-phenylpropanoate (PubChem CID 135146235) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl 2-[[3-methoxy-2-methyl-3-[(2S)-4-methylidenepyrrolidin-2-yl]propanoyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[3-methoxy-2-methyl-3-[(2S)-4-methylidenepyrrolidin-2-yl]propanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 135146235 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | tert-butyl 2-[[3-methoxy-2-methyl-3-[(2S)-4-methylidenepyrrolidin-2-yl]propanoyl]amino]-3-phenylpropanoate |
| SMILES | C=C1CN[C@H](C(OC)C(C)C(=O)NC(Cc2ccccc2)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H34N2O4/c1-15-12-18(24-14-15)20(28-6)16(2)21(26)25-19(22(27)29-23(3,4)5)13-17-10-8-7-9-11-17/h7-11,16,18-20,24H,1,12-14H2,2-6H3,(H,25,26)/t16?,18-,19?,20?/m0/s1 |
| InChIKey | HIUBTNHHTKKGOW-MHINKWEDSA-N |
| XLogP | 2.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|