C17H34BrNO2 — CID 135146365
11-bromoundecyl prop-2-enoate;N,N-dimethylmethanamine (PubChem CID 135146365) has the molecular formula C17H34BrNO2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 11-bromoundecyl prop-2-enoate;N,N-dimethylmethanamine.
| Compound Name | 11-bromoundecyl prop-2-enoate;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 135146365 |
| Molecular Formula | C17H34BrNO2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 11-bromoundecyl prop-2-enoate;N,N-dimethylmethanamine |
| SMILES | C=CC(=O)OCCCCCCCCCCCBr.CN(C)C |
| InChI | InChI=1S/C14H25BrO2.C3H9N/c1-2-14(16)17-13-11-9-7-5-3-4-6-8-10-12-15;1-4(2)3/h2H,1,3-13H2;1-3H3 |
| InChIKey | ONIRKLAUSAEYKR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|