C31H30Cl2N4O2 — CID 135148888
6-chloro-7-(2-chlorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propylphenyl)quinazolin-2-one (PubChem CID 135148888) has the molecular formula C31H30Cl2N4O2 and a molecular weight of 561.51 g/mol. Its IUPAC name is 6-chloro-7-(2-chlorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propylphenyl)quinazolin-2-one.
| Compound Name | 6-chloro-7-(2-chlorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propylphenyl)quinazolin-2-one |
|---|---|
| PubChem CID | 135148888 |
| Molecular Formula | C31H30Cl2N4O2 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 6-chloro-7-(2-chlorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propylphenyl)quinazolin-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3ccccc3CCC)c3cc(-c4ccccc4Cl)c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C31H30Cl2N4O2/c1-4-10-21-11-6-9-14-27(21)37-28-18-23(22-12-7-8-13-25(22)32)26(33)17-24(28)30(34-31(37)39)36-16-15-35(19-20(36)3)29(38)5-2/h5-9,11-14,17-18,20H,2,4,10,15-16,19H2,1,3H3/t20-/m0/s1 |
| InChIKey | RPPYAGSMIJKLIO-FQEVSTJZSA-N |
| XLogP | 6.54 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|