C30H29ClFN5O2 — CID 146235951
6-chloro-7-(2-fluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(3-propyl-2-pyridinyl)quinazolin-2-one (PubChem CID 146235951) has the molecular formula C30H29ClFN5O2 and a molecular weight of 546.05 g/mol. Its IUPAC name is 6-chloro-7-(2-fluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(3-propyl-2-pyridinyl)quinazolin-2-one.
| Compound Name | 6-chloro-7-(2-fluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(3-propyl-2-pyridinyl)quinazolin-2-one |
|---|---|
| PubChem CID | 146235951 |
| Molecular Formula | C30H29ClFN5O2 |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 6-chloro-7-(2-fluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(3-propyl-2-pyridinyl)quinazolin-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3ncccc3CCC)c3cc(-c4ccccc4F)c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C30H29ClFN5O2/c1-4-9-20-10-8-13-33-28(20)37-26-17-22(21-11-6-7-12-25(21)32)24(31)16-23(26)29(34-30(37)39)36-15-14-35(18-19(36)3)27(38)5-2/h5-8,10-13,16-17,19H,2,4,9,14-15,18H2,1,3H3/t19-/m0/s1 |
| InChIKey | YMFIPXSLNPORTM-IBGZPJMESA-N |
| XLogP | 5.42 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|