C25H21ClFN3O2S — CID 135148903
1-[4-[5-chloro-7-fluoro-6-(2-methoxynaphthalen-1-yl)-2,1-benzothiazol-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 135148903) has the molecular formula C25H21ClFN3O2S and a molecular weight of 481.98 g/mol. Its IUPAC name is 1-[4-[5-chloro-7-fluoro-6-(2-methoxynaphthalen-1-yl)-2,1-benzothiazol-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-chloro-7-fluoro-6-(2-methoxynaphthalen-1-yl)-2,1-benzothiazol-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135148903 |
| Molecular Formula | C25H21ClFN3O2S |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 1-[4-[5-chloro-7-fluoro-6-(2-methoxynaphthalen-1-yl)-2,1-benzothiazol-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2snc3c(F)c(-c4c(OC)ccc5ccccc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C25H21ClFN3O2S/c1-3-20(31)29-10-12-30(13-11-29)25-17-14-18(26)22(23(27)24(17)28-33-25)21-16-7-5-4-6-15(16)8-9-19(21)32-2/h3-9,14H,1,10-13H2,2H3 |
| InChIKey | KHIIRMDGTVWFLU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|