C23H19ClN4O2S — CID 135148735
1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-[1,2]thiazolo[3,4-b]pyridin-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 135148735) has the molecular formula C23H19ClN4O2S and a molecular weight of 450.95 g/mol. Its IUPAC name is 1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-[1,2]thiazolo[3,4-b]pyridin-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-[1,2]thiazolo[3,4-b]pyridin-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135148735 |
| Molecular Formula | C23H19ClN4O2S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-[1,2]thiazolo[3,4-b]pyridin-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2snc3nc(-c4cc(O)cc5ccccc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C23H19ClN4O2S/c1-2-20(30)27-7-9-28(10-8-27)23-18-13-19(24)21(25-22(18)26-31-23)17-12-15(29)11-14-5-3-4-6-16(14)17/h2-6,11-13,29H,1,7-10H2 |
| InChIKey | KFGVQZSEBDUXSU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|