C24H23ClN4O2S — CID 167076216
1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-4,5-dihydro-[1,2]thiazolo[3,4-b]pyridin-3-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 167076216) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is 1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-4,5-dihydro-[1,2]thiazolo[3,4-b]pyridin-3-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-4,5-dihydro-[1,2]thiazolo[3,4-b]pyridin-3-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167076216 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 1-[4-[5-chloro-6-(3-hydroxynaphthalen-1-yl)-4,5-dihydro-[1,2]thiazolo[3,4-b]pyridin-3-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2snc3c2CC(Cl)C(c2cc(O)cc4ccccc24)=N3)C(C)C1 |
| InChI | InChI=1S/C24H23ClN4O2S/c1-3-21(31)28-8-9-29(14(2)13-28)24-19-12-20(25)22(26-23(19)27-32-24)18-11-16(30)10-15-6-4-5-7-17(15)18/h3-7,10-11,14,20,30H,1,8-9,12-13H2,2H3 |
| InChIKey | GOAWSLXYRIZPHM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|