C15H14BrClFN3OS — CID 163934139
1-[(3S)-4-(6-bromo-5-chloro-7-fluoro-2,1-benzothiazol-3-yl)-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 163934139) has the molecular formula C15H14BrClFN3OS and a molecular weight of 418.72 g/mol. Its IUPAC name is 1-[(3S)-4-(6-bromo-5-chloro-7-fluoro-2,1-benzothiazol-3-yl)-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-4-(6-bromo-5-chloro-7-fluoro-2,1-benzothiazol-3-yl)-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163934139 |
| Molecular Formula | C15H14BrClFN3OS |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 1-[(3S)-4-(6-bromo-5-chloro-7-fluoro-2,1-benzothiazol-3-yl)-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2snc3c(F)c(Br)c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C15H14BrClFN3OS/c1-3-11(22)20-4-5-21(8(2)7-20)15-9-6-10(17)12(16)13(18)14(9)19-23-15/h3,6,8H,1,4-5,7H2,2H3/t8-/m0/s1 |
| InChIKey | RLFSRBZSPTUCOM-QMMMGPOBSA-N |
| XLogP | 4.07 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|