C25H23ClFN3O2S — CID 147204301
1-[(2S)-4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-2-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 147204301) has the molecular formula C25H23ClFN3O2S and a molecular weight of 484.00 g/mol. Its IUPAC name is 1-[(2S)-4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-2-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S)-4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 147204301 |
| Molecular Formula | C25H23ClFN3O2S |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 1-[(2S)-4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=S)c2cc(Cl)c(-c3cc(O)cc4ccccc34)c(F)c2N)C[C@@H]1C |
| InChI | InChI=1S/C25H23ClFN3O2S/c1-3-21(32)30-9-8-29(13-14(30)2)25(33)19-12-20(26)22(23(27)24(19)28)18-11-16(31)10-15-6-4-5-7-17(15)18/h3-7,10-12,14,31H,1,8-9,13,28H2,2H3/t14-/m0/s1 |
| InChIKey | AMGDYNCSKXAPBC-AWEZNQCLSA-N |
| XLogP | 4.98 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|