C23H19ClFN3O2S — CID 167076127
2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)-N-(1-prop-2-enoylazetidin-3-yl)benzenecarbothioamide (PubChem CID 167076127) has the molecular formula C23H19ClFN3O2S and a molecular weight of 455.94 g/mol. Its IUPAC name is 2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)-N-(1-prop-2-enoylazetidin-3-yl)benzenecarbothioamide.
| Compound Name | 2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)-N-(1-prop-2-enoylazetidin-3-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 167076127 |
| Molecular Formula | C23H19ClFN3O2S |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)-N-(1-prop-2-enoylazetidin-3-yl)benzenecarbothioamide |
| SMILES | C=CC(=O)N1CC(NC(=S)c2cc(Cl)c(-c3cc(O)cc4ccccc34)c(F)c2N)C1 |
| InChI | InChI=1S/C23H19ClFN3O2S/c1-2-19(30)28-10-13(11-28)27-23(31)17-9-18(24)20(21(25)22(17)26)16-8-14(29)7-12-5-3-4-6-15(12)16/h2-9,13,29H,1,10-11,26H2,(H,27,31) |
| InChIKey | BOLMUUJSPJLCNN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|