C25H21ClF3N3O2S — CID 142388240
1-[4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-3-(difluoromethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 142388240) has the molecular formula C25H21ClF3N3O2S and a molecular weight of 519.98 g/mol. Its IUPAC name is 1-[4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-3-(difluoromethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-3-(difluoromethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142388240 |
| Molecular Formula | C25H21ClF3N3O2S |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 1-[4-[2-amino-5-chloro-3-fluoro-4-(3-hydroxynaphthalen-1-yl)benzenecarbothioyl]-3-(difluoromethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=S)c2cc(Cl)c(-c3cc(O)cc4ccccc34)c(F)c2N)C(C(F)F)C1 |
| InChI | InChI=1S/C25H21ClF3N3O2S/c1-2-20(34)31-7-8-32(19(12-31)24(28)29)25(35)17-11-18(26)21(22(27)23(17)30)16-10-14(33)9-13-5-3-4-6-15(13)16/h2-6,9-11,19,24,33H,1,7-8,12,30H2 |
| InChIKey | UTMDOGKMEWGCIP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|