C20H17Cl2F2N3O2S — CID 166698564
1-[4-[2-amino-5-chloro-4-(2-chloro-4-fluoro-5-hydroxyphenyl)-3-fluorobenzenecarbothioyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 166698564) has the molecular formula C20H17Cl2F2N3O2S and a molecular weight of 472.34 g/mol. Its IUPAC name is 1-[4-[2-amino-5-chloro-4-(2-chloro-4-fluoro-5-hydroxyphenyl)-3-fluorobenzenecarbothioyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-amino-5-chloro-4-(2-chloro-4-fluoro-5-hydroxyphenyl)-3-fluorobenzenecarbothioyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166698564 |
| Molecular Formula | C20H17Cl2F2N3O2S |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 1-[4-[2-amino-5-chloro-4-(2-chloro-4-fluoro-5-hydroxyphenyl)-3-fluorobenzenecarbothioyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=S)c2cc(Cl)c(-c3cc(O)c(F)cc3Cl)c(F)c2N)CC1 |
| InChI | InChI=1S/C20H17Cl2F2N3O2S/c1-2-16(29)26-3-5-27(6-4-26)20(30)11-7-13(22)17(18(24)19(11)25)10-8-15(28)14(23)9-12(10)21/h2,7-9,28H,1,3-6,25H2 |
| InChIKey | UTGJBMRZDQWXEV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|