C16H19Cl2N3O3 — CID 170069828
1-[4-[2-(4,5-dichloro-2-hydroxy-N-methylanilino)acetyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 170069828) has the molecular formula C16H19Cl2N3O3 and a molecular weight of 372.25 g/mol. Its IUPAC name is 1-[4-[2-(4,5-dichloro-2-hydroxy-N-methylanilino)acetyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-(4,5-dichloro-2-hydroxy-N-methylanilino)acetyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170069828 |
| Molecular Formula | C16H19Cl2N3O3 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-[4-[2-(4,5-dichloro-2-hydroxy-N-methylanilino)acetyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)CN(C)c2cc(Cl)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C16H19Cl2N3O3/c1-3-15(23)20-4-6-21(7-5-20)16(24)10-19(2)13-8-11(17)12(18)9-14(13)22/h3,8-9,22H,1,4-7,10H2,2H3 |
| InChIKey | BEQJLWPXOXCXAW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|