C19H25ClN4O3 — CID 86279885
1-[3-[4-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 86279885) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is 1-[3-[4-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 86279885 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[3-[4-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CCN(C(=O)CNc3cc(C)c(Cl)cc3O)CC2)C1 |
| InChI | InChI=1S/C19H25ClN4O3/c1-3-18(26)24-11-14(12-24)22-4-6-23(7-5-22)19(27)10-21-16-8-13(2)15(20)9-17(16)25/h3,8-9,14,21,25H,1,4-7,10-12H2,2H3 |
| InChIKey | NCNFUYOVFARQBL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|