C15H21Cl3N4O2 — CID 131734446
1-[4-(azetidin-3-yl)piperazin-1-yl]-2-(4,5-dichloro-2-hydroxyanilino)ethanone;hydrochloride (PubChem CID 131734446) has the molecular formula C15H21Cl3N4O2 and a molecular weight of 395.72 g/mol. Its IUPAC name is 1-[4-(azetidin-3-yl)piperazin-1-yl]-2-(4,5-dichloro-2-hydroxyanilino)ethanone;hydrochloride.
| Compound Name | 1-[4-(azetidin-3-yl)piperazin-1-yl]-2-(4,5-dichloro-2-hydroxyanilino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 131734446 |
| Molecular Formula | C15H21Cl3N4O2 |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[4-(azetidin-3-yl)piperazin-1-yl]-2-(4,5-dichloro-2-hydroxyanilino)ethanone;hydrochloride |
| SMILES | Cl.O=C(CNc1cc(Cl)c(Cl)cc1O)N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C15H20Cl2N4O2.ClH/c16-11-5-13(14(22)6-12(11)17)19-9-15(23)21-3-1-20(2-4-21)10-7-18-8-10;/h5-6,10,18-19,22H,1-4,7-9H2;1H |
| InChIKey | KOOGUQZFUWSNLM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|