C15H20ClN3O3 — CID 134369108
1-(4-acetylpiperazin-1-yl)-2-(4-chloro-2-hydroxy-5-methylanilino)ethanone (PubChem CID 134369108) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-(4-chloro-2-hydroxy-5-methylanilino)ethanone.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-(4-chloro-2-hydroxy-5-methylanilino)ethanone |
|---|---|
| PubChem CID | 134369108 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-(4-chloro-2-hydroxy-5-methylanilino)ethanone |
| SMILES | CC(=O)N1CCN(C(=O)CNc2cc(C)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-10-7-13(14(21)8-12(10)16)17-9-15(22)19-5-3-18(4-6-19)11(2)20/h7-8,17,21H,3-6,9H2,1-2H3 |
| InChIKey | HZOJUILYYDPFTL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|