C19H28ClN3O3 — CID 142573040
N-[1-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperidin-4-yl]prop-2-enamide;ethane (PubChem CID 142573040) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is N-[1-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperidin-4-yl]prop-2-enamide;ethane.
| Compound Name | N-[1-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperidin-4-yl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 142573040 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[1-[2-(4-chloro-2-hydroxy-5-methylanilino)acetyl]piperidin-4-yl]prop-2-enamide;ethane |
| SMILES | C=CC(=O)NC1CCN(C(=O)CNc2cc(C)c(Cl)cc2O)CC1.CC |
| InChI | InChI=1S/C17H22ClN3O3.C2H6/c1-3-16(23)20-12-4-6-21(7-5-12)17(24)10-19-14-8-11(2)13(18)9-15(14)22;1-2/h3,8-9,12,19,22H,1,4-7,10H2,2H3,(H,20,23);1-2H3 |
| InChIKey | NINNIJFJVWNRGI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|