C17H20Cl2N2O3 — CID 147159563
1-(4,5-dichloro-2-hydroxyanilino)-3-(1-prop-2-enoylpiperidin-4-yl)propan-2-one (PubChem CID 147159563) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is 1-(4,5-dichloro-2-hydroxyanilino)-3-(1-prop-2-enoylpiperidin-4-yl)propan-2-one.
| Compound Name | 1-(4,5-dichloro-2-hydroxyanilino)-3-(1-prop-2-enoylpiperidin-4-yl)propan-2-one |
|---|---|
| PubChem CID | 147159563 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-(4,5-dichloro-2-hydroxyanilino)-3-(1-prop-2-enoylpiperidin-4-yl)propan-2-one |
| SMILES | C=CC(=O)N1CCC(CC(=O)CNc2cc(Cl)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C17H20Cl2N2O3/c1-2-17(24)21-5-3-11(4-6-21)7-12(22)10-20-15-8-13(18)14(19)9-16(15)23/h2,8-9,11,20,23H,1,3-7,10H2 |
| InChIKey | BVOIDNONRMLRBK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|