C21H29ClN4O3 — CID 86279230
(2S)-2-(4-chloro-5-ethyl-2-hydroxyanilino)-1-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propan-1-one (PubChem CID 86279230) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is (2S)-2-(4-chloro-5-ethyl-2-hydroxyanilino)-1-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propan-1-one.
| Compound Name | (2S)-2-(4-chloro-5-ethyl-2-hydroxyanilino)-1-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 86279230 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (2S)-2-(4-chloro-5-ethyl-2-hydroxyanilino)-1-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propan-1-one |
| SMILES | C=CC(=O)N1CC(N2CCN(C(=O)[C@H](C)Nc3cc(CC)c(Cl)cc3O)CC2)C1 |
| InChI | InChI=1S/C21H29ClN4O3/c1-4-15-10-18(19(27)11-17(15)22)23-14(3)21(29)25-8-6-24(7-9-25)16-12-26(13-16)20(28)5-2/h5,10-11,14,16,23,27H,2,4,6-9,12-13H2,1,3H3/t14-/m0/s1 |
| InChIKey | IQXYWQPKMDRBAH-AWEZNQCLSA-N |
| XLogP | 1.95 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|