C24H27ClN4O2 — CID 137497921
1-[3-[5-[(4-chloro-5-cyclopropyl-2-hydroxyanilino)methyl]-3,4-dihydro-1H-2,6-naphthyridin-2-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 137497921) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 1-[3-[5-[(4-chloro-5-cyclopropyl-2-hydroxyanilino)methyl]-3,4-dihydro-1H-2,6-naphthyridin-2-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[5-[(4-chloro-5-cyclopropyl-2-hydroxyanilino)methyl]-3,4-dihydro-1H-2,6-naphthyridin-2-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 137497921 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-[3-[5-[(4-chloro-5-cyclopropyl-2-hydroxyanilino)methyl]-3,4-dihydro-1H-2,6-naphthyridin-2-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CCc3c(ccnc3CNc3cc(C4CC4)c(Cl)cc3O)C2)C1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-2-24(31)29-13-17(14-29)28-8-6-18-16(12-28)5-7-26-22(18)11-27-21-9-19(15-3-4-15)20(25)10-23(21)30/h2,5,7,9-10,15,17,27,30H,1,3-4,6,8,11-14H2 |
| InChIKey | VZZAAWPSPHTCDJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|