C23H27ClN4O2 — CID 140721347
5-chloro-4-cyclopropyl-2-[3-oxo-3-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propyl]benzonitrile (PubChem CID 140721347) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 5-chloro-4-cyclopropyl-2-[3-oxo-3-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propyl]benzonitrile.
| Compound Name | 5-chloro-4-cyclopropyl-2-[3-oxo-3-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propyl]benzonitrile |
|---|---|
| PubChem CID | 140721347 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 5-chloro-4-cyclopropyl-2-[3-oxo-3-[4-(1-prop-2-enoylazetidin-3-yl)piperazin-1-yl]propyl]benzonitrile |
| SMILES | C=CC(=O)N1CC(N2CCN(C(=O)CCc3cc(C4CC4)c(Cl)cc3C#N)CC2)C1 |
| InChI | InChI=1S/C23H27ClN4O2/c1-2-22(29)28-14-19(15-28)26-7-9-27(10-8-26)23(30)6-5-17-11-20(16-3-4-16)21(24)12-18(17)13-25/h2,11-12,16,19H,1,3-10,14-15H2 |
| InChIKey | CREKRFNXALYZIM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|