C18H26ClN7O2 — CID 145284869
1-[3-[4-[2-(3-amino-5-chloro-2-hydrazinylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 145284869) has the molecular formula C18H26ClN7O2 and a molecular weight of 407.91 g/mol. Its IUPAC name is 1-[3-[4-[2-(3-amino-5-chloro-2-hydrazinylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[2-(3-amino-5-chloro-2-hydrazinylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 145284869 |
| Molecular Formula | C18H26ClN7O2 |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[3-[4-[2-(3-amino-5-chloro-2-hydrazinylanilino)acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CCN(C(=O)CNc3cc(Cl)cc(N)c3NN)CC2)C1 |
| InChI | InChI=1S/C18H26ClN7O2/c1-2-16(27)26-10-13(11-26)24-3-5-25(6-4-24)17(28)9-22-15-8-12(19)7-14(20)18(15)23-21/h2,7-8,13,22-23H,1,3-6,9-11,20-21H2 |
| InChIKey | YLFCBDQNDXYCAJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|