C19H25Cl2N3O2 — CID 134605405
2-(4,5-dichloro-2-hydroxyanilino)-1-(9-prop-2-enyl-2,9-diazaspiro[4.5]decan-2-yl)ethanone (PubChem CID 134605405) has the molecular formula C19H25Cl2N3O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-hydroxyanilino)-1-(9-prop-2-enyl-2,9-diazaspiro[4.5]decan-2-yl)ethanone.
| Compound Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-(9-prop-2-enyl-2,9-diazaspiro[4.5]decan-2-yl)ethanone |
|---|---|
| PubChem CID | 134605405 |
| Molecular Formula | C19H25Cl2N3O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-(9-prop-2-enyl-2,9-diazaspiro[4.5]decan-2-yl)ethanone |
| SMILES | C=CCN1CCCC2(CCN(C(=O)CNc3cc(Cl)c(Cl)cc3O)C2)C1 |
| InChI | InChI=1S/C19H25Cl2N3O2/c1-2-6-23-7-3-4-19(12-23)5-8-24(13-19)18(26)11-22-16-9-14(20)15(21)10-17(16)25/h2,9-10,22,25H,1,3-8,11-13H2 |
| InChIKey | LNXAOSUFLHZEBA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|