C18H16Cl2F4N4O4S — CID 167080301
4-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 167080301) has the molecular formula C18H16Cl2F4N4O4S and a molecular weight of 531.32 g/mol. Its IUPAC name is 4-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 167080301 |
| Molecular Formula | C18H16Cl2F4N4O4S |
| Molecular Weight | 531.32 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 4-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(N2CCN(C(=O)CNc3cc(Cl)c(Cl)cc3O)CC2)c(F)c1F |
| InChI | InChI=1S/C18H16Cl2F4N4O4S/c19-8-5-10(11(29)6-9(8)20)26-7-12(30)27-1-3-28(4-2-27)17-13(21)15(23)18(33(25,31)32)16(24)14(17)22/h5-6,26,29H,1-4,7H2,(H2,25,31,32) |
| InChIKey | YAJIBETVYQKPDK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|