C19H16Cl2F6N4O5S — CID 167080477
2-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-3,5,6-trifluoro-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 167080477) has the molecular formula C19H16Cl2F6N4O5S and a molecular weight of 597.32 g/mol. Its IUPAC name is 2-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-3,5,6-trifluoro-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 2-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-3,5,6-trifluoro-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 167080477 |
| Molecular Formula | C19H16Cl2F6N4O5S |
| Molecular Weight | 597.32 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | 2-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-3,5,6-trifluoro-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(OC(F)(F)F)c(F)c1N1CCN(C(=O)CNc2cc(Cl)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C19H16Cl2F6N4O5S/c20-8-5-10(11(32)6-9(8)21)29-7-12(33)30-1-3-31(4-2-30)16-15(24)17(36-19(25,26)27)13(22)14(23)18(16)37(28,34)35/h5-6,29,32H,1-4,7H2,(H2,28,34,35) |
| InChIKey | MAYURSLAWBTNTM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|