C16H21Cl2N3O3S — CID 71819730
1-[4-[2-(4,5-dichloro-2-methoxyanilino)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one (PubChem CID 71819730) has the molecular formula C16H21Cl2N3O3S and a molecular weight of 406.34 g/mol. Its IUPAC name is 1-[4-[2-(4,5-dichloro-2-methoxyanilino)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one.
| Compound Name | 1-[4-[2-(4,5-dichloro-2-methoxyanilino)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 71819730 |
| Molecular Formula | C16H21Cl2N3O3S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 1-[4-[2-(4,5-dichloro-2-methoxyanilino)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one |
| SMILES | COc1cc(Cl)c(Cl)cc1NCC(=O)N1CCN(C(=O)CCS)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O3S/c1-24-14-9-12(18)11(17)8-13(14)19-10-16(23)21-5-3-20(4-6-21)15(22)2-7-25/h8-9,19,25H,2-7,10H2,1H3 |
| InChIKey | MYMCCOOGGSFCRG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|