C20H30ClN3O4 — CID 123875989
tert-butyl 4-[2-(4-chloro-5-ethyl-2-methoxyanilino)acetyl]piperazine-1-carboxylate (PubChem CID 123875989) has the molecular formula C20H30ClN3O4 and a molecular weight of 411.93 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-chloro-5-ethyl-2-methoxyanilino)acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-chloro-5-ethyl-2-methoxyanilino)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123875989 |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | tert-butyl 4-[2-(4-chloro-5-ethyl-2-methoxyanilino)acetyl]piperazine-1-carboxylate |
| SMILES | CCc1cc(NCC(=O)N2CCN(C(=O)OC(C)(C)C)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H30ClN3O4/c1-6-14-11-16(17(27-5)12-15(14)21)22-13-18(25)23-7-9-24(10-8-23)19(26)28-20(2,3)4/h11-12,22H,6-10,13H2,1-5H3 |
| InChIKey | GNZOJKPYCCSSTC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |