C17H24ClN3O4S — CID 123618131
N-[1-[2-(4-chloro-5-methoxy-2-methylanilino)acetyl]piperidin-4-yl]ethenesulfonamide (PubChem CID 123618131) has the molecular formula C17H24ClN3O4S and a molecular weight of 401.92 g/mol. Its IUPAC name is N-[1-[2-(4-chloro-5-methoxy-2-methylanilino)acetyl]piperidin-4-yl]ethenesulfonamide.
| Compound Name | N-[1-[2-(4-chloro-5-methoxy-2-methylanilino)acetyl]piperidin-4-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 123618131 |
| Molecular Formula | C17H24ClN3O4S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[1-[2-(4-chloro-5-methoxy-2-methylanilino)acetyl]piperidin-4-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC1CCN(C(=O)CNc2cc(OC)c(Cl)cc2C)CC1 |
| InChI | InChI=1S/C17H24ClN3O4S/c1-4-26(23,24)20-13-5-7-21(8-6-13)17(22)11-19-15-10-16(25-3)14(18)9-12(15)2/h4,9-10,13,19-20H,1,5-8,11H2,2-3H3 |
| InChIKey | HOFNJGSGLRHCQU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |