C15H20BrClN4O2 — CID 155215314
2-(5-bromo-4-chloro-2-hydroxyanilino)-1-[3-[3-(methylamino)azetidin-1-yl]azetidin-1-yl]ethanone (PubChem CID 155215314) has the molecular formula C15H20BrClN4O2 and a molecular weight of 403.71 g/mol. Its IUPAC name is 2-(5-bromo-4-chloro-2-hydroxyanilino)-1-[3-[3-(methylamino)azetidin-1-yl]azetidin-1-yl]ethanone.
| Compound Name | 2-(5-bromo-4-chloro-2-hydroxyanilino)-1-[3-[3-(methylamino)azetidin-1-yl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 155215314 |
| Molecular Formula | C15H20BrClN4O2 |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-(5-bromo-4-chloro-2-hydroxyanilino)-1-[3-[3-(methylamino)azetidin-1-yl]azetidin-1-yl]ethanone |
| SMILES | CNC1CN(C2CN(C(=O)CNc3cc(Br)c(Cl)cc3O)C2)C1 |
| InChI | InChI=1S/C15H20BrClN4O2/c1-18-9-5-20(6-9)10-7-21(8-10)15(23)4-19-13-2-11(16)12(17)3-14(13)22/h2-3,9-10,18-19,22H,4-8H2,1H3 |
| InChIKey | QPGQVHBIQKKINR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|