C15H22N4O2 — CID 61018701
3-methyl-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]benzamide (PubChem CID 61018701) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-methyl-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]benzamide.
| Compound Name | 3-methyl-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]benzamide |
|---|---|
| PubChem CID | 61018701 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-methyl-4-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]benzamide |
| SMILES | Cc1cc(C(N)=O)ccc1N(C)CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H22N4O2/c1-11-9-12(15(16)21)3-4-13(11)18(2)10-14(20)19-7-5-17-6-8-19/h3-4,9,17H,5-8,10H2,1-2H3,(H2,16,21) |
| InChIKey | XFHMARWAUGLWRF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |