C14H20N4O3 — CID 61018161
2-(N,3-dimethyl-4-nitroanilino)-1-piperazin-1-ylethanone (PubChem CID 61018161) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(N,3-dimethyl-4-nitroanilino)-1-piperazin-1-ylethanone.
| Compound Name | 2-(N,3-dimethyl-4-nitroanilino)-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 61018161 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-(N,3-dimethyl-4-nitroanilino)-1-piperazin-1-ylethanone |
| SMILES | Cc1cc(N(C)CC(=O)N2CCNCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O3/c1-11-9-12(3-4-13(11)18(20)21)16(2)10-14(19)17-7-5-15-6-8-17/h3-4,9,15H,5-8,10H2,1-2H3 |
| InChIKey | DSQSEUKRJJDZSC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|