C14H21ClN4O6S — CID 119967593
4-methoxy-N-methyl-3-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide;hydrochloride (PubChem CID 119967593) has the molecular formula C14H21ClN4O6S and a molecular weight of 408.86 g/mol. Its IUPAC name is 4-methoxy-N-methyl-3-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-methoxy-N-methyl-3-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119967593 |
| Molecular Formula | C14H21ClN4O6S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 4-methoxy-N-methyl-3-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)N2CCNCC2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H20N4O6S.ClH/c1-16(10-14(19)17-7-5-15-6-8-17)25(22,23)11-3-4-13(24-2)12(9-11)18(20)21;/h3-4,9,15H,5-8,10H2,1-2H3;1H |
| InChIKey | NNDFYQBIKNZXSX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|