C15H23ClN4O5S — CID 119967340
2-methoxy-5-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzamide;hydrochloride (PubChem CID 119967340) has the molecular formula C15H23ClN4O5S and a molecular weight of 406.89 g/mol. Its IUPAC name is 2-methoxy-5-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | 2-methoxy-5-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119967340 |
| Molecular Formula | C15H23ClN4O5S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-methoxy-5-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)N2CCNCC2)cc1C(N)=O.Cl |
| InChI | InChI=1S/C15H22N4O5S.ClH/c1-18(10-14(20)19-7-5-17-6-8-19)25(22,23)11-3-4-13(24-2)12(9-11)15(16)21;/h3-4,9,17H,5-8,10H2,1-2H3,(H2,16,21);1H |
| InChIKey | ZEYCIXGGSZJOEE-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |