C13H18IN3O3S — CID 61018949
4-iodo-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 61018949) has the molecular formula C13H18IN3O3S and a molecular weight of 423.28 g/mol. Its IUPAC name is 4-iodo-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-iodo-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61018949 |
| Molecular Formula | C13H18IN3O3S |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 4-iodo-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | CN(CC(=O)N1CCNCC1)S(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H18IN3O3S/c1-16(10-13(18)17-8-6-15-7-9-17)21(19,20)12-4-2-11(14)3-5-12/h2-5,15H,6-10H2,1H3 |
| InChIKey | GKPMIHNHUQMVCL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|