C29H26ClFN4O2 — CID 137297879
1-[4-[7-chloro-4-(2-ethylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 137297879) has the molecular formula C29H26ClFN4O2 and a molecular weight of 517.00 g/mol. Its IUPAC name is 1-[4-[7-chloro-4-(2-ethylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-chloro-4-(2-ethylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 137297879 |
| Molecular Formula | C29H26ClFN4O2 |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 1-[4-[7-chloro-4-(2-ethylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nnc(-c3ccccc3CC)c3cc(-c4c(O)cccc4F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C29H26ClFN4O2/c1-3-18-8-5-6-9-19(18)28-20-16-22(27-24(31)10-7-11-25(27)36)23(30)17-21(20)29(33-32-28)35-14-12-34(13-15-35)26(37)4-2/h4-11,16-17,36H,2-3,12-15H2,1H3 |
| InChIKey | KWZPNWLSUXCBDL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|