C31H28ClN5O — CID 164784535
1-[4-[4-benzyl-7-chloro-6-(5-methyl-1H-indol-4-yl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 164784535) has the molecular formula C31H28ClN5O and a molecular weight of 522.05 g/mol. Its IUPAC name is 1-[4-[4-benzyl-7-chloro-6-(5-methyl-1H-indol-4-yl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-benzyl-7-chloro-6-(5-methyl-1H-indol-4-yl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164784535 |
| Molecular Formula | C31H28ClN5O |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 1-[4-[4-benzyl-7-chloro-6-(5-methyl-1H-indol-4-yl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nnc(Cc3ccccc3)c3cc(-c4c(C)ccc5[nH]ccc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C31H28ClN5O/c1-3-29(38)36-13-15-37(16-14-36)31-24-19-26(32)25(30-20(2)9-10-27-22(30)11-12-33-27)18-23(24)28(34-35-31)17-21-7-5-4-6-8-21/h3-12,18-19,33H,1,13-17H2,2H3 |
| InChIKey | FTSIOWANYRWGKM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|