C19H18Cl2N4 — CID 135165515
1-benzyl-6,7-dichloro-4-piperazin-1-ylphthalazine (PubChem CID 135165515) has the molecular formula C19H18Cl2N4 and a molecular weight of 373.29 g/mol. Its IUPAC name is 1-benzyl-6,7-dichloro-4-piperazin-1-ylphthalazine.
| Compound Name | 1-benzyl-6,7-dichloro-4-piperazin-1-ylphthalazine |
|---|---|
| PubChem CID | 135165515 |
| Molecular Formula | C19H18Cl2N4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-benzyl-6,7-dichloro-4-piperazin-1-ylphthalazine |
| SMILES | Clc1cc2c(Cc3ccccc3)nnc(N3CCNCC3)c2cc1Cl |
| InChI | InChI=1S/C19H18Cl2N4/c20-16-11-14-15(12-17(16)21)19(25-8-6-22-7-9-25)24-23-18(14)10-13-4-2-1-3-5-13/h1-5,11-12,22H,6-10H2 |
| InChIKey | KBUZTNFUJZXVFY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |