C30H29ClN6O — CID 142388417
1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-4-benzyl-6-chlorophthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 142388417) has the molecular formula C30H29ClN6O and a molecular weight of 525.06 g/mol. Its IUPAC name is 1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-4-benzyl-6-chlorophthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-4-benzyl-6-chlorophthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142388417 |
| Molecular Formula | C30H29ClN6O |
| Molecular Weight | 525.06 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 1-[4-[7-(3-amino-2-methanimidoyl-6-methylphenyl)-4-benzyl-6-chlorophthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)ccc(C)c1-c1cc2c(N3CCN(C(=O)C=C)CC3)nnc(Cc3ccccc3)c2cc1Cl |
| InChI | InChI=1S/C30H29ClN6O/c1-3-28(38)36-11-13-37(14-12-36)30-22-16-23(29-19(2)9-10-26(33)24(29)18-32)25(31)17-21(22)27(34-35-30)15-20-7-5-4-6-8-20/h3-10,16-18,32H,1,11-15,33H2,2H3/b32-18+ |
| InChIKey | UWZGHVQUDFYMFJ-KCSSXMTESA-N |
| XLogP | 5.26 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|