C28H34N8O3 — CID 163740789
1-[4-[8-(3-amino-2-methanimidoyl-6-methylphenoxy)-2-[[(3S)-1-methylpyrrolidin-3-yl]methoxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 163740789) has the molecular formula C28H34N8O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is 1-[4-[8-(3-amino-2-methanimidoyl-6-methylphenoxy)-2-[[(3S)-1-methylpyrrolidin-3-yl]methoxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[8-(3-amino-2-methanimidoyl-6-methylphenoxy)-2-[[(3S)-1-methylpyrrolidin-3-yl]methoxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163740789 |
| Molecular Formula | C28H34N8O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 1-[4-[8-(3-amino-2-methanimidoyl-6-methylphenoxy)-2-[[(3S)-1-methylpyrrolidin-3-yl]methoxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)ccc(C)c1Oc1nccc2c(N3CCN(C(=O)C=C)CC3)nc(OC[C@H]3CCN(C)C3)nc12 |
| InChI | InChI=1S/C28H34N8O3/c1-4-23(37)35-11-13-36(14-12-35)26-20-7-9-31-27(39-25-18(2)5-6-22(30)21(25)15-29)24(20)32-28(33-26)38-17-19-8-10-34(3)16-19/h4-7,9,15,19,29H,1,8,10-14,16-17,30H2,2-3H3/b29-15+/t19-/m0/s1 |
| InChIKey | LHNRRXFJEXZJRH-XNGBXZAESA-N |
| XLogP | 2.87 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|