C30H32ClFN8O4 — CID 139376281
1-[4-[8-(5-amino-2-chloro-3-fluoro-6-methanimidoylphenoxy)-2-[(3R,4R)-1-but-3-ynyl-4-methoxypyrrolidin-3-yl]oxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 139376281) has the molecular formula C30H32ClFN8O4 and a molecular weight of 623.09 g/mol. Its IUPAC name is 1-[4-[8-(5-amino-2-chloro-3-fluoro-6-methanimidoylphenoxy)-2-[(3R,4R)-1-but-3-ynyl-4-methoxypyrrolidin-3-yl]oxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[8-(5-amino-2-chloro-3-fluoro-6-methanimidoylphenoxy)-2-[(3R,4R)-1-but-3-ynyl-4-methoxypyrrolidin-3-yl]oxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139376281 |
| Molecular Formula | C30H32ClFN8O4 |
| Molecular Weight | 623.09 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 1-[4-[8-(5-amino-2-chloro-3-fluoro-6-methanimidoylphenoxy)-2-[(3R,4R)-1-but-3-ynyl-4-methoxypyrrolidin-3-yl]oxypyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)cc(F)c(Cl)c1Oc1nccc2c(N3CCN(C(=O)C=C)CC3)nc(O[C@@H]3CN(CCC#C)C[C@H]3OC)nc12 |
| InChI | InChI=1S/C30H32ClFN8O4/c1-4-6-9-38-16-22(42-3)23(17-38)43-30-36-26-18(28(37-30)40-12-10-39(11-13-40)24(41)5-2)7-8-35-29(26)44-27-19(15-33)21(34)14-20(32)25(27)31/h1,5,7-8,14-15,22-23,33H,2,6,9-13,16-17,34H2,3H3/b33-15+/t22-,23-/m1/s1 |
| InChIKey | YVULAANLVJMUNB-GHTOWJDWSA-N |
| XLogP | 3.13 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.09 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|