C29H25ClFN5O3 — CID 167076287
N-[[5-chloro-2-(3-cyano-N-methylanilino)-4-(2-fluoro-6-hydroxyphenyl)phenyl]-(4-prop-2-enoylpiperazin-1-yl)methylidene]formamide (PubChem CID 167076287) has the molecular formula C29H25ClFN5O3 and a molecular weight of 546.00 g/mol. Its IUPAC name is N-[[5-chloro-2-(3-cyano-N-methylanilino)-4-(2-fluoro-6-hydroxyphenyl)phenyl]-(4-prop-2-enoylpiperazin-1-yl)methylidene]formamide.
| Compound Name | N-[[5-chloro-2-(3-cyano-N-methylanilino)-4-(2-fluoro-6-hydroxyphenyl)phenyl]-(4-prop-2-enoylpiperazin-1-yl)methylidene]formamide |
|---|---|
| PubChem CID | 167076287 |
| Molecular Formula | C29H25ClFN5O3 |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | N-[[5-chloro-2-(3-cyano-N-methylanilino)-4-(2-fluoro-6-hydroxyphenyl)phenyl]-(4-prop-2-enoylpiperazin-1-yl)methylidene]formamide |
| SMILES | C=CC(=O)N1CCN(/C(=N\C=O)c2cc(Cl)c(-c3c(O)cccc3F)cc2N(C)c2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C29H25ClFN5O3/c1-3-27(39)35-10-12-36(13-11-35)29(33-18-37)22-15-23(30)21(28-24(31)8-5-9-26(28)38)16-25(22)34(2)20-7-4-6-19(14-20)17-32/h3-9,14-16,18,38H,1,10-13H2,2H3/b33-29- |
| InChIKey | NOZHZRKJQQKMPT-IYOYZZHUSA-N |
| XLogP | 4.72 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|