C22H16ClF2N5O3 — CID 155352454
1-[4-[5-chloro-3-fluoro-4-(2-fluoro-6-hydroxyphenyl)-1-nitrosoazirino[2,3-b]quinolin-7-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 155352454) has the molecular formula C22H16ClF2N5O3 and a molecular weight of 471.85 g/mol. Its IUPAC name is 1-[4-[5-chloro-3-fluoro-4-(2-fluoro-6-hydroxyphenyl)-1-nitrosoazirino[2,3-b]quinolin-7-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-chloro-3-fluoro-4-(2-fluoro-6-hydroxyphenyl)-1-nitrosoazirino[2,3-b]quinolin-7-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155352454 |
| Molecular Formula | C22H16ClF2N5O3 |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 1-[4-[5-chloro-3-fluoro-4-(2-fluoro-6-hydroxyphenyl)-1-nitrosoazirino[2,3-b]quinolin-7-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2c3c(nc4c(F)c(-c5c(O)cccc5F)c(Cl)cc24)N3N=O)CC1 |
| InChI | InChI=1S/C22H16ClF2N5O3/c1-2-15(32)28-6-8-29(9-7-28)20-11-10-12(23)16(17-13(24)4-3-5-14(17)31)18(25)19(11)26-22-21(20)30(22)27-33/h2-5,10,31H,1,6-9H2 |
| InChIKey | OYTRDPZMROVCPO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|