C25H22ClF2N3O3 — CID 149070744
1-[4-(4-acetylpiperazin-1-yl)-6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)quinolin-3-yl]but-3-en-2-one (PubChem CID 149070744) has the molecular formula C25H22ClF2N3O3 and a molecular weight of 485.92 g/mol. Its IUPAC name is 1-[4-(4-acetylpiperazin-1-yl)-6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)quinolin-3-yl]but-3-en-2-one.
| Compound Name | 1-[4-(4-acetylpiperazin-1-yl)-6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)quinolin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 149070744 |
| Molecular Formula | C25H22ClF2N3O3 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[4-(4-acetylpiperazin-1-yl)-6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)quinolin-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cnc2c(F)c(-c3c(O)cccc3F)c(Cl)cc2c1N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C25H22ClF2N3O3/c1-3-16(33)11-15-13-29-24-17(25(15)31-9-7-30(8-10-31)14(2)32)12-18(26)21(23(24)28)22-19(27)5-4-6-20(22)34/h3-6,12-13,34H,1,7-11H2,2H3 |
| InChIKey | QNSYWEQZLBPQCQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|