C26H22ClF2N3O3 — CID 160605023
1-[4-[7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-3-methylidene-4H-pyrano[2,3-b]quinolin-5-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 160605023) has the molecular formula C26H22ClF2N3O3 and a molecular weight of 497.93 g/mol. Its IUPAC name is 1-[4-[7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-3-methylidene-4H-pyrano[2,3-b]quinolin-5-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-3-methylidene-4H-pyrano[2,3-b]quinolin-5-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 160605023 |
| Molecular Formula | C26H22ClF2N3O3 |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 1-[4-[7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-3-methylidene-4H-pyrano[2,3-b]quinolin-5-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2c3c(nc4c(F)c(-c5c(O)cccc5F)c(Cl)cc24)OCC(=C)C3)CC1 |
| InChI | InChI=1S/C26H22ClF2N3O3/c1-3-20(34)31-7-9-32(10-8-31)25-15-12-17(27)21(22-18(28)5-4-6-19(22)33)23(29)24(15)30-26-16(25)11-14(2)13-35-26/h3-6,12,33H,1-2,7-11,13H2 |
| InChIKey | PUHWWJSMUUSWOI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|