C25H21N3O3 — CID 135280471
5-(3-hydroxynaphthalen-1-yl)-1-(1-prop-2-enoylazetidin-3-yl)indole-4-carboxamide (PubChem CID 135280471) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 5-(3-hydroxynaphthalen-1-yl)-1-(1-prop-2-enoylazetidin-3-yl)indole-4-carboxamide.
| Compound Name | 5-(3-hydroxynaphthalen-1-yl)-1-(1-prop-2-enoylazetidin-3-yl)indole-4-carboxamide |
|---|---|
| PubChem CID | 135280471 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 5-(3-hydroxynaphthalen-1-yl)-1-(1-prop-2-enoylazetidin-3-yl)indole-4-carboxamide |
| SMILES | C=CC(=O)N1CC(n2ccc3c(C(N)=O)c(-c4cc(O)cc5ccccc45)ccc32)C1 |
| InChI | InChI=1S/C25H21N3O3/c1-2-23(30)27-13-16(14-27)28-10-9-20-22(28)8-7-19(24(20)25(26)31)21-12-17(29)11-15-5-3-4-6-18(15)21/h2-12,16,29H,1,13-14H2,(H2,26,31) |
| InChIKey | MEZIRRNSZUVHJI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|